C29H45N5O7S — CID 101164813
(2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 101164813) has the molecular formula C29H45N5O7S and a molecular weight of 607.77 g/mol. Its IUPAC name is (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 101164813 |
| Molecular Formula | C29H45N5O7S |
| Molecular Weight | 607.77 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | (2S)-6-acetamido-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CSCC[C@H](NC=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCNC(C)=O)C(=O)O |
| InChI | InChI=1S/C29H45N5O7S/c1-19(2)16-24(33-26(37)22(31-18-35)13-15-42-4)27(38)34-25(17-21-10-6-5-7-11-21)28(39)32-23(29(40)41)12-8-9-14-30-20(3)36/h5-7,10-11,18-19,22-25H,8-9,12-17H2,1-4H3,(H,30,36)(H,31,35)(H,32,39)(H,33,37)(H,34,38)(H,40,41)/t22-,23-,24-,25-/m0/s1 |
| InChIKey | CSPMCLMFXJETQO-QORCZRPOSA-N |
| XLogP | 0.99 |
| TPSA | 182.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.77 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|