C26H33N3O5 — CID 156569259
2-[[2-[[(2S)-2-formamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 156569259) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 2-[[2-[[(2S)-2-formamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[2-[[(2S)-2-formamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 156569259 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 2-[[2-[[(2S)-2-formamido-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)[C@H](CCc1ccccc1)NC=O)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H33N3O5/c1-18(2)15-22(25(32)29-23(26(33)34)16-20-11-7-4-8-12-20)28-24(31)21(27-17-30)14-13-19-9-5-3-6-10-19/h3-12,17-18,21-23H,13-16H2,1-2H3,(H,27,30)(H,28,31)(H,29,32)(H,33,34)/t21-,22?,23?/m0/s1 |
| InChIKey | DMIWXSNCFBRHRJ-UVKLAMSESA-N |
| XLogP | 2.08 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|