C43H64N6O9 — CID 23196259
2-[[2-[2-[[2-[[2-(2-formamidohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid (PubChem CID 23196259) has the molecular formula C43H64N6O9 and a molecular weight of 809.02 g/mol. Its IUPAC name is 2-[[2-[2-[[2-[[2-(2-formamidohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[2-[[2-[[2-(2-formamidohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 23196259 |
| Molecular Formula | C43H64N6O9 |
| Molecular Weight | 809.02 g/mol |
| Exact Mass | 808.47 |
| IUPAC Name | 2-[[2-[2-[[2-[[2-(2-formamidohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]hexanoylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCCCC(NC=O)C(=O)NC(CC(C)C)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCC)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C43H64N6O9/c1-7-9-16-32(44-26-50)38(52)46-34(22-27(3)4)40(54)48-35(24-29-14-12-11-13-15-29)41(55)45-33(17-10-8-2)39(53)47-36(25-30-18-20-31(51)21-19-30)42(56)49-37(43(57)58)23-28(5)6/h11-15,18-21,26-28,32-37,51H,7-10,16-17,22-25H2,1-6H3,(H,44,50)(H,45,55)(H,46,52)(H,47,53)(H,48,54)(H,49,56)(H,57,58) |
| InChIKey | WNKXRHKETSXFJS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 232.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.02 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|