C25H37Cl2N3O6 — CID 20832988
1,3-dichloropropan-2-one;2-[[2-(2-formamidohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 20832988) has the molecular formula C25H37Cl2N3O6 and a molecular weight of 546.49 g/mol. Its IUPAC name is 1,3-dichloropropan-2-one;2-[[2-(2-formamidohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 1,3-dichloropropan-2-one;2-[[2-(2-formamidohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 20832988 |
| Molecular Formula | C25H37Cl2N3O6 |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 1,3-dichloropropan-2-one;2-[[2-(2-formamidohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CCCCC(NC=O)C(=O)NC(CC(C)C)C(=O)NC(Cc1ccccc1)C(=O)O.O=C(CCl)CCl |
| InChI | InChI=1S/C22H33N3O5.C3H4Cl2O/c1-4-5-11-17(23-14-26)20(27)24-18(12-15(2)3)21(28)25-19(22(29)30)13-16-9-7-6-8-10-16;4-1-3(6)2-5/h6-10,14-15,17-19H,4-5,11-13H2,1-3H3,(H,23,26)(H,24,27)(H,25,28)(H,29,30);1-2H2 |
| InChIKey | KTNLECXPQZVUSI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 141.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|