C34H54N5O8+ — CID 59010991
[5-carbamoyl-11-[(2S)-2-[[(2S)-2-[[(2S)-2-formamidohexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]oxy-7,10-dioxoundecyl]azanium (PubChem CID 59010991) has the molecular formula C34H54N5O8+ and a molecular weight of 660.83 g/mol. Its IUPAC name is [5-carbamoyl-11-[(2S)-2-[[(2S)-2-[[(2S)-2-formamidohexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]oxy-7,10-dioxoundecyl]azanium.
| Compound Name | [5-carbamoyl-11-[(2S)-2-[[(2S)-2-[[(2S)-2-formamidohexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]oxy-7,10-dioxoundecyl]azanium |
|---|---|
| PubChem CID | 59010991 |
| Molecular Formula | C34H54N5O8+ |
| Molecular Weight | 660.83 g/mol |
| Exact Mass | 660.40 |
| IUPAC Name | [5-carbamoyl-11-[(2S)-2-[[(2S)-2-[[(2S)-2-formamidohexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]oxy-7,10-dioxoundecyl]azanium |
| SMILES | CCCC[C@H](NC=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCC(=O)CCC(=O)CC(CCCC[NH3+])C(N)=O |
| InChI | InChI=1S/C34H53N5O8/c1-4-5-14-28(37-22-40)32(44)38-29(18-23(2)3)33(45)39-30(19-24-11-7-6-8-12-24)34(46)47-21-27(42)16-15-26(41)20-25(31(36)43)13-9-10-17-35/h6-8,11-12,22-23,25,28-30H,4-5,9-10,13-21,35H2,1-3H3,(H2,36,43)(H,37,40)(H,38,44)(H,39,45)/p+1/t25?,28-,29-,30-/m0/s1 |
| InChIKey | SBVUBKNVQQHLEB-ASHGWBGTSA-O |
| XLogP | 0.92 |
| TPSA | 218.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.83 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|