C29H38IN3O5 — CID 67478486
(2S)-2-[[(2S)-2-[[(2S)-2-(4-iodobutanoylamino)-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid (PubChem CID 67478486) has the molecular formula C29H38IN3O5 and a molecular weight of 635.54 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-(4-iodobutanoylamino)-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-(4-iodobutanoylamino)-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67478486 |
| Molecular Formula | C29H38IN3O5 |
| Molecular Weight | 635.54 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-(4-iodobutanoylamino)-4-phenylbutanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCc1ccccc1)NC(=O)CCCI)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H38IN3O5/c1-20(2)18-24(28(36)33-25(29(37)38)19-22-12-7-4-8-13-22)32-27(35)23(31-26(34)14-9-17-30)16-15-21-10-5-3-6-11-21/h3-8,10-13,20,23-25H,9,14-19H2,1-2H3,(H,31,34)(H,32,35)(H,33,36)(H,37,38)/t23-,24-,25-/m0/s1 |
| InChIKey | RSTXURBUFFJCTG-SDHOMARFSA-N |
| XLogP | 3.66 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|