C17H26N2O2 — CID 71457400
(2S)-N,4-dimethyl-2-(4-phenylbutanoylamino)pentanamide (PubChem CID 71457400) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is (2S)-N,4-dimethyl-2-(4-phenylbutanoylamino)pentanamide.
| Compound Name | (2S)-N,4-dimethyl-2-(4-phenylbutanoylamino)pentanamide |
|---|---|
| PubChem CID | 71457400 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (2S)-N,4-dimethyl-2-(4-phenylbutanoylamino)pentanamide |
| SMILES | CNC(=O)[C@H](CC(C)C)NC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C17H26N2O2/c1-13(2)12-15(17(21)18-3)19-16(20)11-7-10-14-8-5-4-6-9-14/h4-6,8-9,13,15H,7,10-12H2,1-3H3,(H,18,21)(H,19,20)/t15-/m0/s1 |
| InChIKey | VEPDXWLWVHAIMM-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |