C13H27N3O2 — CID 82848725
2-(5-aminohexanoylamino)-N,4-dimethylpentanamide (PubChem CID 82848725) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-(5-aminohexanoylamino)-N,4-dimethylpentanamide.
| Compound Name | 2-(5-aminohexanoylamino)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 82848725 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 2-(5-aminohexanoylamino)-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC(=O)CCCC(C)N |
| InChI | InChI=1S/C13H27N3O2/c1-9(2)8-11(13(18)15-4)16-12(17)7-5-6-10(3)14/h9-11H,5-8,14H2,1-4H3,(H,15,18)(H,16,17) |
| InChIKey | MJURCGZMENMCEX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |