C8H18N2O — CID 72516454
N,4-dimethyl-2-(methylamino)pentanamide (PubChem CID 72516454) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is N,4-dimethyl-2-(methylamino)pentanamide.
| Compound Name | N,4-dimethyl-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 72516454 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | N,4-dimethyl-2-(methylamino)pentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC |
| InChI | InChI=1S/C8H18N2O/c1-6(2)5-7(9-3)8(11)10-4/h6-7,9H,5H2,1-4H3,(H,10,11) |
| InChIKey | FEPOARYFCLWDHV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |