C8H18N2O3S — CID 13443889
2-(methanesulfonamido)-N,4-dimethylpentanamide (PubChem CID 13443889) has the molecular formula C8H18N2O3S and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-(methanesulfonamido)-N,4-dimethylpentanamide.
| Compound Name | 2-(methanesulfonamido)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 13443889 |
| Molecular Formula | C8H18N2O3S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-(methanesulfonamido)-N,4-dimethylpentanamide |
| SMILES | CNC(=O)C(CC(C)C)NS(C)(=O)=O |
| InChI | InChI=1S/C8H18N2O3S/c1-6(2)5-7(8(11)9-3)10-14(4,12)13/h6-7,10H,5H2,1-4H3,(H,9,11) |
| InChIKey | UKYSKVOZBIKACF-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |