C13H28N2O4S — CID 10781140
(2R)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-(methanesulfonamido)-4-methylpentanamide (PubChem CID 10781140) has the molecular formula C13H28N2O4S and a molecular weight of 308.44 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-(methanesulfonamido)-4-methylpentanamide.
| Compound Name | (2R)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-(methanesulfonamido)-4-methylpentanamide |
|---|---|
| PubChem CID | 10781140 |
| Molecular Formula | C13H28N2O4S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | (2R)-N-[(2S)-1-hydroxy-4-methylpentan-2-yl]-2-(methanesulfonamido)-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](CO)NC(=O)[C@@H](CC(C)C)NS(C)(=O)=O |
| InChI | InChI=1S/C13H28N2O4S/c1-9(2)6-11(8-16)14-13(17)12(7-10(3)4)15-20(5,18)19/h9-12,15-16H,6-8H2,1-5H3,(H,14,17)/t11-,12+/m0/s1 |
| InChIKey | RFZPQLYNCODIML-NWDGAFQWSA-N |
| XLogP | 0.47 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |