C11H24N2O4S — CID 43500595
N-(1-hydroxy-2-methylpropan-2-yl)-2-(methanesulfonamido)-4-methylpentanamide (PubChem CID 43500595) has the molecular formula C11H24N2O4S and a molecular weight of 280.39 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylpropan-2-yl)-2-(methanesulfonamido)-4-methylpentanamide.
| Compound Name | N-(1-hydroxy-2-methylpropan-2-yl)-2-(methanesulfonamido)-4-methylpentanamide |
|---|---|
| PubChem CID | 43500595 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-(1-hydroxy-2-methylpropan-2-yl)-2-(methanesulfonamido)-4-methylpentanamide |
| SMILES | CC(C)CC(NS(C)(=O)=O)C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C11H24N2O4S/c1-8(2)6-9(13-18(5,16)17)10(15)12-11(3,4)7-14/h8-9,13-14H,6-7H2,1-5H3,(H,12,15) |
| InChIKey | AUGAJUQEICYPPQ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |