C10H20N2O5S — CID 43431214
methyl 2-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]acetate (PubChem CID 43431214) has the molecular formula C10H20N2O5S and a molecular weight of 280.35 g/mol. Its IUPAC name is methyl 2-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]acetate.
| Compound Name | methyl 2-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]acetate |
|---|---|
| PubChem CID | 43431214 |
| Molecular Formula | C10H20N2O5S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 2-[[2-(methanesulfonamido)-4-methylpentanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)C(CC(C)C)NS(C)(=O)=O |
| InChI | InChI=1S/C10H20N2O5S/c1-7(2)5-8(12-18(4,15)16)10(14)11-6-9(13)17-3/h7-8,12H,5-6H2,1-4H3,(H,11,14) |
| InChIKey | JEBKLQUCLHQPLI-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |