C7H13NO5S — CID 115582753
methyl 2-(2-methylsulfonylpropanoylamino)acetate (PubChem CID 115582753) has the molecular formula C7H13NO5S and a molecular weight of 223.25 g/mol. Its IUPAC name is methyl 2-(2-methylsulfonylpropanoylamino)acetate.
| Compound Name | methyl 2-(2-methylsulfonylpropanoylamino)acetate |
|---|---|
| PubChem CID | 115582753 |
| Molecular Formula | C7H13NO5S |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | methyl 2-(2-methylsulfonylpropanoylamino)acetate |
| SMILES | COC(=O)CNC(=O)C(C)S(C)(=O)=O |
| InChI | InChI=1S/C7H13NO5S/c1-5(14(3,11)12)7(10)8-4-6(9)13-2/h5H,4H2,1-3H3,(H,8,10) |
| InChIKey | DUJGQMVVKUVQSR-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |