C9H17NO6S — CID 104517700
3-hydroxy-3-methyl-4-(2-methylsulfonylpropanoylamino)butanoic acid (PubChem CID 104517700) has the molecular formula C9H17NO6S and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-hydroxy-3-methyl-4-(2-methylsulfonylpropanoylamino)butanoic acid.
| Compound Name | 3-hydroxy-3-methyl-4-(2-methylsulfonylpropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 104517700 |
| Molecular Formula | C9H17NO6S |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 3-hydroxy-3-methyl-4-(2-methylsulfonylpropanoylamino)butanoic acid |
| SMILES | CC(C(=O)NCC(C)(O)CC(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C9H17NO6S/c1-6(17(3,15)16)8(13)10-5-9(2,14)4-7(11)12/h6,14H,4-5H2,1-3H3,(H,10,13)(H,11,12) |
| InChIKey | FUIFBPCNFDIJQA-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |