C10H20BrNO3S — CID 106143542
N-(4-bromo-2,2-dimethylbutyl)-2-methylsulfonylpropanamide (PubChem CID 106143542) has the molecular formula C10H20BrNO3S and a molecular weight of 314.25 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)-2-methylsulfonylpropanamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 106143542 |
| Molecular Formula | C10H20BrNO3S |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)NCC(C)(C)CCBr)S(C)(=O)=O |
| InChI | InChI=1S/C10H20BrNO3S/c1-8(16(4,14)15)9(13)12-7-10(2,3)5-6-11/h8H,5-7H2,1-4H3,(H,12,13) |
| InChIKey | APSKOADLPLHFII-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|