C10H19NO5S — CID 112700739
4-methyl-4-(2-methylsulfonylpropanoylamino)pentanoic acid (PubChem CID 112700739) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-methyl-4-(2-methylsulfonylpropanoylamino)pentanoic acid.
| Compound Name | 4-methyl-4-(2-methylsulfonylpropanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 112700739 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-methyl-4-(2-methylsulfonylpropanoylamino)pentanoic acid |
| SMILES | CC(C(=O)NC(C)(C)CCC(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C10H19NO5S/c1-7(17(4,15)16)9(14)11-10(2,3)6-5-8(12)13/h7H,5-6H2,1-4H3,(H,11,14)(H,12,13) |
| InChIKey | IDELCFADSHQSCP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |