C16H29NO3 — CID 119204002
4-[(3-cyclohexyl-2-methylpropanoyl)amino]-4-methylpentanoic acid (PubChem CID 119204002) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-[(3-cyclohexyl-2-methylpropanoyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(3-cyclohexyl-2-methylpropanoyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119204002 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 4-[(3-cyclohexyl-2-methylpropanoyl)amino]-4-methylpentanoic acid |
| SMILES | CC(CC1CCCCC1)C(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C16H29NO3/c1-12(11-13-7-5-4-6-8-13)15(20)17-16(2,3)10-9-14(18)19/h12-13H,4-11H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | RUBPQQAPNJOHBL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |