C16H31NO3 — CID 103159401
6-[(3-cyclopentyl-2-hydroxypropyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 103159401) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 6-[(3-cyclopentyl-2-hydroxypropyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(3-cyclopentyl-2-hydroxypropyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 103159401 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 6-[(3-cyclopentyl-2-hydroxypropyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNCC(O)CC1CCCC1)CCC(=O)O |
| InChI | InChI=1S/C16H31NO3/c1-16(2,8-7-15(19)20)9-10-17-12-14(18)11-13-5-3-4-6-13/h13-14,17-18H,3-12H2,1-2H3,(H,19,20) |
| InChIKey | SQWNRPCFMMRISG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|