C15H31NO2 — CID 114200371
6-(2,4-dimethylpentylamino)-4,4-dimethylhexanoic acid (PubChem CID 114200371) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 6-(2,4-dimethylpentylamino)-4,4-dimethylhexanoic acid.
| Compound Name | 6-(2,4-dimethylpentylamino)-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 114200371 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 6-(2,4-dimethylpentylamino)-4,4-dimethylhexanoic acid |
| SMILES | CC(C)CC(C)CNCCC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C15H31NO2/c1-12(2)10-13(3)11-16-9-8-15(4,5)7-6-14(17)18/h12-13,16H,6-11H2,1-5H3,(H,17,18) |
| InChIKey | KESWBKBJDZDXBF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|