C17H35NO2 — CID 65287173
4,4-dimethyl-6-(nonylamino)hexanoic acid (PubChem CID 65287173) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is 4,4-dimethyl-6-(nonylamino)hexanoic acid.
| Compound Name | 4,4-dimethyl-6-(nonylamino)hexanoic acid |
|---|---|
| PubChem CID | 65287173 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | 4,4-dimethyl-6-(nonylamino)hexanoic acid |
| SMILES | CCCCCCCCCNCCC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C17H35NO2/c1-4-5-6-7-8-9-10-14-18-15-13-17(2,3)12-11-16(19)20/h18H,4-15H2,1-3H3,(H,19,20) |
| InChIKey | FIZDNJMZIUJMER-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|