About 6-(hexylamino)hexanoic acid
6-(hexylamino)hexanoic acid (PubChem CID 18001086) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 6-(hexylamino)hexanoic acid.
Molecular Properties
| Compound Name | 6-(hexylamino)hexanoic acid |
| PubChem CID | 18001086 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 6-(hexylamino)hexanoic acid |
| SMILES | CCCCCCNCCCCCC(=O)O |
| InChI | InChI=1S/C12H25NO2/c1-2-3-4-7-10-13-11-8-5-6-9-12(14)15/h13H,2-11H2,1H3,(H,14,15) |
| InChIKey | UOJPMCQETRVUDB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(hexylamino)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(hexylamino)hexanoic acid?
The IUPAC name of 6-(hexylamino)hexanoic acid (CID 18001086) is 6-(hexylamino)hexanoic acid.
What is the SMILES notation for 6-(hexylamino)hexanoic acid?
The canonical SMILES for 6-(hexylamino)hexanoic acid is CCCCCCNCCCCCC(=O)O.
What is the InChIKey of 6-(hexylamino)hexanoic acid?
The InChIKey is UOJPMCQETRVUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-2-3-4-7-10-13-11-8-5-6-9-12(14)15/h13H,2-11H2,1H3,(H,14,15).
What are the key properties of 6-(hexylamino)hexanoic acid?
6-(hexylamino)hexanoic acid has a molecular weight of 215.34 g/mol, XLogP of 2.80, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(hexylamino)hexanoic acid is sourced from PubChem (CID 18001086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).