About N-butylbutan-1-amine;decanedioic acid
N-butylbutan-1-amine;decanedioic acid (PubChem CID 159923840) has the molecular formula C18H37NO4
and a molecular weight of 331.50 g/mol. Its IUPAC name is N-butylbutan-1-amine;decanedioic acid.
Molecular Properties
| Compound Name | N-butylbutan-1-amine;decanedioic acid |
| PubChem CID | 159923840 |
| Molecular Formula | C18H37NO4 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.27 |
| IUPAC Name | N-butylbutan-1-amine;decanedioic acid |
| SMILES | CCCCNCCCC.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.C8H19N/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;1-3-5-7-9-8-6-4-2/h1-8H2,(H,11,12)(H,13,14);9H,3-8H2,1-2H3 |
| InChIKey | NYTIBVARRAEMTN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylbutan-1-amine;decanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylbutan-1-amine;decanedioic acid?
The IUPAC name of N-butylbutan-1-amine;decanedioic acid (CID 159923840) is N-butylbutan-1-amine;decanedioic acid.
What is the SMILES notation for N-butylbutan-1-amine;decanedioic acid?
The canonical SMILES for N-butylbutan-1-amine;decanedioic acid is CCCCNCCCC.O=C(O)CCCCCCCCC(=O)O.
What is the InChIKey of N-butylbutan-1-amine;decanedioic acid?
The InChIKey is NYTIBVARRAEMTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4.C8H19N/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;1-3-5-7-9-8-6-4-2/h1-8H2,(H,11,12)(H,13,14);9H,3-8H2,1-2H3.
What are the key properties of N-butylbutan-1-amine;decanedioic acid?
N-butylbutan-1-amine;decanedioic acid has a molecular weight of 331.50 g/mol, XLogP of 4.45, 15 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylbutan-1-amine;decanedioic acid is sourced from PubChem (CID 159923840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).