C10H20N2O3 — CID 65287286
6-[(2-amino-2-oxoethyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 65287286) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 6-[(2-amino-2-oxoethyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(2-amino-2-oxoethyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65287286 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 6-[(2-amino-2-oxoethyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNCC(N)=O)CCC(=O)O |
| InChI | InChI=1S/C10H20N2O3/c1-10(2,4-3-9(14)15)5-6-12-7-8(11)13/h12H,3-7H2,1-2H3,(H2,11,13)(H,14,15) |
| InChIKey | PZCAYCVOPWGQOX-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|