C13H26N2O3 — CID 65287716
6-[[3-(ethylamino)-3-oxopropyl]amino]-4,4-dimethylhexanoic acid (PubChem CID 65287716) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-[[3-(ethylamino)-3-oxopropyl]amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[[3-(ethylamino)-3-oxopropyl]amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65287716 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 6-[[3-(ethylamino)-3-oxopropyl]amino]-4,4-dimethylhexanoic acid |
| SMILES | CCNC(=O)CCNCCC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C13H26N2O3/c1-4-15-11(16)6-9-14-10-8-13(2,3)7-5-12(17)18/h14H,4-10H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | VNRCRXDVNFECDQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|