C16H32N2O3 — CID 83142689
4,4-dimethyl-6-(2,3,3-trimethylbutylcarbamoylamino)hexanoic acid (PubChem CID 83142689) has the molecular formula C16H32N2O3 and a molecular weight of 300.44 g/mol. Its IUPAC name is 4,4-dimethyl-6-(2,3,3-trimethylbutylcarbamoylamino)hexanoic acid.
| Compound Name | 4,4-dimethyl-6-(2,3,3-trimethylbutylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 83142689 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | 4,4-dimethyl-6-(2,3,3-trimethylbutylcarbamoylamino)hexanoic acid |
| SMILES | CC(CNC(=O)NCCC(C)(C)CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H32N2O3/c1-12(15(2,3)4)11-18-14(21)17-10-9-16(5,6)8-7-13(19)20/h12H,7-11H2,1-6H3,(H,19,20)(H2,17,18,21) |
| InChIKey | DNGQKPHVADDDLK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |