4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid

C12H20N2O3 — CID 65285527

IUPAC4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid
SMILESC#CCNC(=O)NCCC(C)(C)CCC(=O)O
InChIInChI=1S/C12H20N2O3/c1-4-8-13-11(17)14-9-7-12(2,3)6-5-10(15)16/h1H,5-9H2,2-3H3,(H,15,16)(H2,13,14,17)
InChIKeyOSPAVGJCJSSWFA-UHFFFAOYSA-N
MW240.30 g/mol
LogP1.20
Rot. Bonds7

About 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid

4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid (PubChem CID 65285527) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid.

Molecular Properties

Compound Name4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid
PubChem CID65285527
Molecular FormulaC12H20N2O3
Molecular Weight240.30 g/mol
Exact Mass240.15
IUPAC Name4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid
SMILESC#CCNC(=O)NCCC(C)(C)CCC(=O)O
InChIInChI=1S/C12H20N2O3/c1-4-8-13-11(17)14-9-7-12(2,3)6-5-10(15)16/h1H,5-9H2,2-3H3,(H,15,16)(H2,13,14,17)
InChIKeyOSPAVGJCJSSWFA-UHFFFAOYSA-N
XLogP1.20
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.30
LogP ≤ 51.20
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid?
The IUPAC name of 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid (CID 65285527) is 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid.
What is the SMILES notation for 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid?
The canonical SMILES for 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid is C#CCNC(=O)NCCC(C)(C)CCC(=O)O.
What is the InChIKey of 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid?
The InChIKey is OSPAVGJCJSSWFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3/c1-4-8-13-11(17)14-9-7-12(2,3)6-5-10(15)16/h1H,5-9H2,2-3H3,(H,15,16)(H2,13,14,17).
What are the key properties of 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid?
4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid has a molecular weight of 240.30 g/mol, XLogP of 1.20, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid is sourced from PubChem (CID 65285527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).