C12H20N2O3 — CID 65285527
4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid (PubChem CID 65285527) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid.
| Compound Name | 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 65285527 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 4,4-dimethyl-6-(prop-2-ynylcarbamoylamino)hexanoic acid |
| SMILES | C#CCNC(=O)NCCC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C12H20N2O3/c1-4-8-13-11(17)14-9-7-12(2,3)6-5-10(15)16/h1H,5-9H2,2-3H3,(H,15,16)(H2,13,14,17) |
| InChIKey | OSPAVGJCJSSWFA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|