C14H25NO3 — CID 83147001
6-(2-cyclopropylpropanoylamino)-4,4-dimethylhexanoic acid (PubChem CID 83147001) has the molecular formula C14H25NO3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 6-(2-cyclopropylpropanoylamino)-4,4-dimethylhexanoic acid.
| Compound Name | 6-(2-cyclopropylpropanoylamino)-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 83147001 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 6-(2-cyclopropylpropanoylamino)-4,4-dimethylhexanoic acid |
| SMILES | CC(C(=O)NCCC(C)(C)CCC(=O)O)C1CC1 |
| InChI | InChI=1S/C14H25NO3/c1-10(11-4-5-11)13(18)15-9-8-14(2,3)7-6-12(16)17/h10-11H,4-9H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | JQXVUUOCXYASML-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |