C15H28N2O3 — CID 65285791
6-[(4-aminocyclohexanecarbonyl)amino]-4,4-dimethylhexanoic acid (PubChem CID 65285791) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 6-[(4-aminocyclohexanecarbonyl)amino]-4,4-dimethylhexanoic acid.
| Compound Name | 6-[(4-aminocyclohexanecarbonyl)amino]-4,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 65285791 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 6-[(4-aminocyclohexanecarbonyl)amino]-4,4-dimethylhexanoic acid |
| SMILES | CC(C)(CCNC(=O)C1CCC(N)CC1)CCC(=O)O |
| InChI | InChI=1S/C15H28N2O3/c1-15(2,8-7-13(18)19)9-10-17-14(20)11-3-5-12(16)6-4-11/h11-12H,3-10,16H2,1-2H3,(H,17,20)(H,18,19) |
| InChIKey | DSKISUJXGZDGHI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |