C10H17F3N2O — CID 63227240
4-amino-N-(3,3,3-trifluoropropyl)cyclohexane-1-carboxamide (PubChem CID 63227240) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-amino-N-(3,3,3-trifluoropropyl)cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-(3,3,3-trifluoropropyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 63227240 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 4-amino-N-(3,3,3-trifluoropropyl)cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)NCCC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3N2O/c11-10(12,13)5-6-15-9(16)7-1-3-8(14)4-2-7/h7-8H,1-6,14H2,(H,15,16) |
| InChIKey | WHTLEYMSYRVHEL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |