C10H17F3N2OS — CID 113228177
4-amino-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxamide (PubChem CID 113228177) has the molecular formula C10H17F3N2OS and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-amino-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-amino-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 113228177 |
| Molecular Formula | C10H17F3N2OS |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-amino-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexane-1-carboxamide |
| SMILES | NC1CCC(C(=O)NCCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3N2OS/c11-10(12,13)17-6-5-15-9(16)7-1-3-8(14)4-2-7/h7-8H,1-6,14H2,(H,15,16) |
| InChIKey | UQBUJFMQBXEDAL-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|