C9H14F3N3O2S — CID 99773480
(3R)-1-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidine-1,3-dicarboxamide (PubChem CID 99773480) has the molecular formula C9H14F3N3O2S and a molecular weight of 285.29 g/mol. Its IUPAC name is (3R)-1-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 99773480 |
| Molecular Formula | C9H14F3N3O2S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | (3R)-1-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CCN(C(=O)NCCSC(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3N3O2S/c10-9(11,12)18-4-2-14-8(17)15-3-1-6(5-15)7(13)16/h6H,1-5H2,(H2,13,16)(H,14,17)/t6-/m1/s1 |
| InChIKey | KPNLUMAJFSPSHO-ZCFIWIBFSA-N |
| XLogP | 0.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|