C12H16BrN3O2S — CID 94049302
(3R)-1-N-[2-(5-bromothiophen-2-yl)ethyl]pyrrolidine-1,3-dicarboxamide (PubChem CID 94049302) has the molecular formula C12H16BrN3O2S and a molecular weight of 346.25 g/mol. Its IUPAC name is (3R)-1-N-[2-(5-bromothiophen-2-yl)ethyl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-[2-(5-bromothiophen-2-yl)ethyl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94049302 |
| Molecular Formula | C12H16BrN3O2S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | (3R)-1-N-[2-(5-bromothiophen-2-yl)ethyl]pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CCN(C(=O)NCCc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C12H16BrN3O2S/c13-10-2-1-9(19-10)3-5-15-12(18)16-6-4-8(7-16)11(14)17/h1-2,8H,3-7H2,(H2,14,17)(H,15,18)/t8-/m1/s1 |
| InChIKey | KJMKWQRKCDZUSC-MRVPVSSYSA-N |
| XLogP | 1.57 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |