C12H15BrN2O4S — CID 103994688
1-[2-(5-bromothiophen-2-yl)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 103994688) has the molecular formula C12H15BrN2O4S and a molecular weight of 363.23 g/mol. Its IUPAC name is 1-[2-(5-bromothiophen-2-yl)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-(5-bromothiophen-2-yl)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 103994688 |
| Molecular Formula | C12H15BrN2O4S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 1-[2-(5-bromothiophen-2-yl)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CN1C(=O)NCCc1ccc(Br)s1 |
| InChI | InChI=1S/C12H15BrN2O4S/c13-10-2-1-8(20-10)3-4-14-12(19)15-6-7(16)5-9(15)11(17)18/h1-2,7,9,16H,3-6H2,(H,14,19)(H,17,18) |
| InChIKey | DFNQNORKXCVTEO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |