C15H20N2O4 — CID 79000393
(2R,4R)-4-hydroxy-1-(3-phenylpropylcarbamoyl)pyrrolidine-2-carboxylic acid (PubChem CID 79000393) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is (2R,4R)-4-hydroxy-1-(3-phenylpropylcarbamoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4R)-4-hydroxy-1-(3-phenylpropylcarbamoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79000393 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (2R,4R)-4-hydroxy-1-(3-phenylpropylcarbamoyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](O)CN1C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C15H20N2O4/c18-12-9-13(14(19)20)17(10-12)15(21)16-8-4-7-11-5-2-1-3-6-11/h1-3,5-6,12-13,18H,4,7-10H2,(H,16,21)(H,19,20)/t12-,13-/m1/s1 |
| InChIKey | VSPUXFHJIOFXNV-CHWSQXEVSA-N |
| XLogP | 0.85 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|