C9H18N4O2 — CID 82508838
1-N-(2-aminoethyl)piperidine-1,4-dicarboxamide (PubChem CID 82508838) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 1-N-(2-aminoethyl)piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-(2-aminoethyl)piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 82508838 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-N-(2-aminoethyl)piperidine-1,4-dicarboxamide |
| SMILES | NCCNC(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C9H18N4O2/c10-3-4-12-9(15)13-5-1-7(2-6-13)8(11)14/h7H,1-6,10H2,(H2,11,14)(H,12,15) |
| InChIKey | BIQYQOLYWQQQDG-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |