C10H20N4O2 — CID 77039009
4-(N'-hydroxycarbamimidoyl)-N-propylpiperidine-1-carboxamide (PubChem CID 77039009) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 4-(N'-hydroxycarbamimidoyl)-N-propylpiperidine-1-carboxamide.
| Compound Name | 4-(N'-hydroxycarbamimidoyl)-N-propylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 77039009 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 4-(N'-hydroxycarbamimidoyl)-N-propylpiperidine-1-carboxamide |
| SMILES | CCCNC(=O)N1CCC(C(N)=NO)CC1 |
| InChI | InChI=1S/C10H20N4O2/c1-2-5-12-10(15)14-6-3-8(4-7-14)9(11)13-16/h8,16H,2-7H2,1H3,(H2,11,13)(H,12,15) |
| InChIKey | DFUCAKNRFBSFDG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|