C14H21N5O2 — CID 71897846
1-N-[2-(pyridin-2-ylamino)ethyl]piperidine-1,4-dicarboxamide (PubChem CID 71897846) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-N-[2-(pyridin-2-ylamino)ethyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[2-(pyridin-2-ylamino)ethyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 71897846 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-N-[2-(pyridin-2-ylamino)ethyl]piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NCCNc2ccccn2)CC1 |
| InChI | InChI=1S/C14H21N5O2/c15-13(20)11-4-9-19(10-5-11)14(21)18-8-7-17-12-3-1-2-6-16-12/h1-3,6,11H,4-5,7-10H2,(H2,15,20)(H,16,17)(H,18,21) |
| InChIKey | CKVXJNGZZUZJSK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|