C17H21N5O2 — CID 56820950
1-N-[(2-pyrazol-1-ylphenyl)methyl]piperidine-1,4-dicarboxamide (PubChem CID 56820950) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-N-[(2-pyrazol-1-ylphenyl)methyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(2-pyrazol-1-ylphenyl)methyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 56820950 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 1-N-[(2-pyrazol-1-ylphenyl)methyl]piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NCc2ccccc2-n2cccn2)CC1 |
| InChI | InChI=1S/C17H21N5O2/c18-16(23)13-6-10-21(11-7-13)17(24)19-12-14-4-1-2-5-15(14)22-9-3-8-20-22/h1-5,8-9,13H,6-7,10-12H2,(H2,18,23)(H,19,24) |
| InChIKey | CCNVOVGICDXHCS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |