C16H19N5O2 — CID 94658479
(3R)-1-N-[(2-imidazol-1-ylphenyl)methyl]pyrrolidine-1,3-dicarboxamide (PubChem CID 94658479) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is (3R)-1-N-[(2-imidazol-1-ylphenyl)methyl]pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-[(2-imidazol-1-ylphenyl)methyl]pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94658479 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (3R)-1-N-[(2-imidazol-1-ylphenyl)methyl]pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CCN(C(=O)NCc2ccccc2-n2ccnc2)C1 |
| InChI | InChI=1S/C16H19N5O2/c17-15(22)13-5-7-20(10-13)16(23)19-9-12-3-1-2-4-14(12)21-8-6-18-11-21/h1-4,6,8,11,13H,5,7,9-10H2,(H2,17,22)(H,19,23)/t13-/m1/s1 |
| InChIKey | UQEDWCBPOCCNGW-CYBMUJFWSA-N |
| XLogP | 0.89 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |