C13H11N5OS — CID 84595607
N-[(2-imidazol-1-ylphenyl)methyl]thiadiazole-4-carboxamide (PubChem CID 84595607) has the molecular formula C13H11N5OS and a molecular weight of 285.33 g/mol. Its IUPAC name is N-[(2-imidazol-1-ylphenyl)methyl]thiadiazole-4-carboxamide.
| Compound Name | N-[(2-imidazol-1-ylphenyl)methyl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 84595607 |
| Molecular Formula | C13H11N5OS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-[(2-imidazol-1-ylphenyl)methyl]thiadiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1-n1ccnc1)c1csnn1 |
| InChI | InChI=1S/C13H11N5OS/c19-13(11-8-20-17-16-11)15-7-10-3-1-2-4-12(10)18-6-5-14-9-18/h1-6,8-9H,7H2,(H,15,19) |
| InChIKey | ZVZRPCYTUQAPAE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |