C21H22FN5O3S — CID 60580721
4-(2-fluorophenyl)sulfonyl-N-[(2-imidazol-1-ylphenyl)methyl]piperazine-1-carboxamide (PubChem CID 60580721) has the molecular formula C21H22FN5O3S and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-(2-fluorophenyl)sulfonyl-N-[(2-imidazol-1-ylphenyl)methyl]piperazine-1-carboxamide.
| Compound Name | 4-(2-fluorophenyl)sulfonyl-N-[(2-imidazol-1-ylphenyl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60580721 |
| Molecular Formula | C21H22FN5O3S |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 4-(2-fluorophenyl)sulfonyl-N-[(2-imidazol-1-ylphenyl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1-n1ccnc1)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H22FN5O3S/c22-18-6-2-4-8-20(18)31(29,30)27-13-11-25(12-14-27)21(28)24-15-17-5-1-3-7-19(17)26-10-9-23-16-26/h1-10,16H,11-15H2,(H,24,28) |
| InChIKey | YEHDCUHTAKNGDN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |