C21H24FN5O3S — CID 55457370
N-[3-(benzimidazol-1-yl)propyl]-4-(2-fluorophenyl)sulfonylpiperazine-1-carboxamide (PubChem CID 55457370) has the molecular formula C21H24FN5O3S and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-4-(2-fluorophenyl)sulfonylpiperazine-1-carboxamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-4-(2-fluorophenyl)sulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 55457370 |
| Molecular Formula | C21H24FN5O3S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-4-(2-fluorophenyl)sulfonylpiperazine-1-carboxamide |
| SMILES | O=C(NCCCn1cnc2ccccc21)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H24FN5O3S/c22-17-6-1-4-9-20(17)31(29,30)27-14-12-25(13-15-27)21(28)23-10-5-11-26-16-24-18-7-2-3-8-19(18)26/h1-4,6-9,16H,5,10-15H2,(H,23,28) |
| InChIKey | IVQLOQDWUYSLIB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|