C22H26N4O3S — CID 55408023
1-(benzenesulfonyl)-N-[3-(benzimidazol-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 55408023) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[3-(benzimidazol-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[3-(benzimidazol-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55408023 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[3-(benzimidazol-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCCn1cnc2ccccc21)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H26N4O3S/c27-22(23-13-6-14-25-17-24-20-9-4-5-10-21(20)25)18-11-15-26(16-12-18)30(28,29)19-7-2-1-3-8-19/h1-5,7-10,17-18H,6,11-16H2,(H,23,27) |
| InChIKey | CEWUVEHTCYHCKG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|