C21H33N3O3S — CID 133167065
1-(benzenesulfonyl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 133167065) has the molecular formula C21H33N3O3S and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133167065 |
| Molecular Formula | C21H33N3O3S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)C2CCN(S(=O)(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C21H33N3O3S/c1-18-7-5-13-23(17-18)14-6-12-22-21(25)19-10-15-24(16-11-19)28(26,27)20-8-3-2-4-9-20/h2-4,8-9,18-19H,5-7,10-17H2,1H3,(H,22,25) |
| InChIKey | LCQQZUBUUUXDJA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|