C22H35N3O4S — CID 133167714
1-(4-methoxyphenyl)sulfonyl-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide (PubChem CID 133167714) has the molecular formula C22H35N3O4S and a molecular weight of 437.61 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)sulfonyl-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-methoxyphenyl)sulfonyl-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133167714 |
| Molecular Formula | C22H35N3O4S |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | 1-(4-methoxyphenyl)sulfonyl-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)NCCCN3CCCC(C)C3)CC2)cc1 |
| InChI | InChI=1S/C22H35N3O4S/c1-18-5-3-13-24(17-18)14-4-12-23-22(26)19-10-15-25(16-11-19)30(27,28)21-8-6-20(29-2)7-9-21/h6-9,18-19H,3-5,10-17H2,1-2H3,(H,23,26) |
| InChIKey | TWVNPMFOZKGEJS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|