C16H31N3O3S — CID 94119857
N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-1-methylsulfonylpiperidine-4-carboxamide (PubChem CID 94119857) has the molecular formula C16H31N3O3S and a molecular weight of 345.51 g/mol. Its IUPAC name is N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-1-methylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-1-methylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 94119857 |
| Molecular Formula | C16H31N3O3S |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[3-[(3S)-3-methylpiperidin-1-yl]propyl]-1-methylsulfonylpiperidine-4-carboxamide |
| SMILES | C[C@H]1CCCN(CCCNC(=O)C2CCN(S(C)(=O)=O)CC2)C1 |
| InChI | InChI=1S/C16H31N3O3S/c1-14-5-3-9-18(13-14)10-4-8-17-16(20)15-6-11-19(12-7-15)23(2,21)22/h14-15H,3-13H2,1-2H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | SXRNQHRUZVJPPY-AWEZNQCLSA-N |
| XLogP | 0.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|