C23H38N6O — CID 92888526
N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-1-(6-pyrrolidin-1-ylpyridazin-3-yl)piperidine-4-carboxamide (PubChem CID 92888526) has the molecular formula C23H38N6O and a molecular weight of 414.60 g/mol. Its IUPAC name is N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-1-(6-pyrrolidin-1-ylpyridazin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-1-(6-pyrrolidin-1-ylpyridazin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 92888526 |
| Molecular Formula | C23H38N6O |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]-1-(6-pyrrolidin-1-ylpyridazin-3-yl)piperidine-4-carboxamide |
| SMILES | C[C@@H]1CCCN(CCCNC(=O)C2CCN(c3ccc(N4CCCC4)nn3)CC2)C1 |
| InChI | InChI=1S/C23H38N6O/c1-19-6-4-12-27(18-19)13-5-11-24-23(30)20-9-16-29(17-10-20)22-8-7-21(25-26-22)28-14-2-3-15-28/h7-8,19-20H,2-6,9-18H2,1H3,(H,24,30)/t19-/m1/s1 |
| InChIKey | QDFWOOJMUBKNNG-LJQANCHMSA-N |
| XLogP | 2.53 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|