C22H32N4O3S — CID 55718213
1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-3-carboxamide (PubChem CID 55718213) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-3-carboxamide.
| Compound Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55718213 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 1-(1,1-dioxo-1,2-benzothiazol-3-yl)-N-[3-(3-methylpiperidin-1-yl)propyl]piperidine-3-carboxamide |
| SMILES | CC1CCCN(CCCNC(=O)C2CCCN(C3=NS(=O)(=O)c4ccccc43)C2)C1 |
| InChI | InChI=1S/C22H32N4O3S/c1-17-7-4-12-25(15-17)13-6-11-23-22(27)18-8-5-14-26(16-18)21-19-9-2-3-10-20(19)30(28,29)24-21/h2-3,9-10,17-18H,4-8,11-16H2,1H3,(H,23,27) |
| InChIKey | SJFPZDVNLIVNAO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|