C25H36N6O — CID 50771294
N-[3-(N-methylanilino)propyl]-1-(6-piperidin-1-ylpyridazin-3-yl)piperidine-4-carboxamide (PubChem CID 50771294) has the molecular formula C25H36N6O and a molecular weight of 436.60 g/mol. Its IUPAC name is N-[3-(N-methylanilino)propyl]-1-(6-piperidin-1-ylpyridazin-3-yl)piperidine-4-carboxamide.
| Compound Name | N-[3-(N-methylanilino)propyl]-1-(6-piperidin-1-ylpyridazin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 50771294 |
| Molecular Formula | C25H36N6O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | N-[3-(N-methylanilino)propyl]-1-(6-piperidin-1-ylpyridazin-3-yl)piperidine-4-carboxamide |
| SMILES | CN(CCCNC(=O)C1CCN(c2ccc(N3CCCCC3)nn2)CC1)c1ccccc1 |
| InChI | InChI=1S/C25H36N6O/c1-29(22-9-4-2-5-10-22)16-8-15-26-25(32)21-13-19-31(20-14-21)24-12-11-23(27-28-24)30-17-6-3-7-18-30/h2,4-5,9-12,21H,3,6-8,13-20H2,1H3,(H,26,32) |
| InChIKey | MFMNMGNQAODFAW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|